| MolName | 2-(2,4-dichlorophenyl)-N-[(Z)-[1-(3-nitrophenyl)pyrrol-2-yl]methylideneamino]quinoline-4-carboxamide |
| MolecularFormula | C27H17N5O3Cl2 |
| Smiles | [O-][N+](c1cccc(-n2c(/C=N\NC(c3cc(-c(ccc(Cl)c4)c4Cl)nc4ccccc34)=O)ccc2)c1)=O |
| InChI | InChI=1S/C27H17Cl2N5O3/c28-17-10-11-22(24(29)13-17)26-15-23(21-8-1-2-9-25(21)31-26)27(35)32-30-16-20-7-4-12-33(20)18-5-3-6-19(14-18)34(36)37/h1-16H,(H,32,35) |
| InChIK | HADFFUQHTACAAA-UHFFFAOYSA-N |
| TotalMolweight | 530.37 |
| Molweight | 530.37 |
| MonoisotopicMass | 529.070844 |
| CLogP | 5.7971 |
| CLogS | -10.474 |
| H Acceptors | 8 |
| H Donors | 1 |
| TotalSurfaceArea | 383.58 |
| Relative PSA | 0.21969 |
| PolarSurfaceArea | 105.1 |
| Druglikeness | 0.36337 |
| Mutagenic | none |
| Tumorigenic | high |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.51351 |
| Fragments | 1 |
| Non HAtoms | 37 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 6 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 5 |
| Aromatic Atoms | 27 |
| Sp3Atoms | 1 |
| Aromatic Nitrogens | 2 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-(2,4-dichlorophenyl)-N-[(Z)-[1-(3-nitrophenyl)pyrrol-2-yl]methylideneamino]quinoline-4-carboxamide | 2 - 2-(2,4-dichlorophenyl)-N-[(Z)-[1-(3-nitrophenyl)pyrrol-2-yl]methylideneamino]quinoline-4-carboxamide