| MolName | N-[(Z)-2-bicyclo[2.2.1]hept-5-enylmethylideneamino]-2-hydroxybenzamide |
| MolecularFormula | C15H16N2O2 |
| Smiles | Oc(cccc1)c1C(N/N=C\C(C1)C2C=CC1C2)=O |
| InChI | InChI=1S/C15H16N2O2/c18-14-4-2-1-3-13(14)15(19)17-16-9-12-8-10-5-6-11(12)7-10/h1-6,9-12,18H,7-8H2,(H,17,19) |
| InChIK | HADKJZRNEAFHSM-UHFFFAOYSA-N |
| TotalMolweight | 256.304 |
| Molweight | 256.304 |
| MonoisotopicMass | 256.121178 |
| CLogP | 2.0733 |
| CLogS | -3.411 |
| H Acceptors | 4 |
| H Donors | 2 |
| TotalSurfaceArea | 198.1 |
| Relative PSA | 0.24791 |
| PolarSurfaceArea | 61.69 |
| Druglikeness | 4.7555 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | low |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.63158 |
| Fragments | 1 |
| Non HAtoms | 19 |
| NonCHAtoms | 4 |
| Electronegative Atoms | 4 |
| StereoCenters | 3 |
| Rotatable Bond | 3 |
| Rings Closures | 3 |
| Small Rings | 4 |
| Aromatic Rings | 1 |
| Aromatic Atoms | 6 |
| Sp3Atoms | 6 |
| StereoCon | unknown chirality |
Click to Load Molecule:
1 - N-[(Z)-2-bicyclo[2.2.1]hept-5-enylmethylideneamino]-2-hydroxybenzamide | 2 - N-[(Z)-2-bicyclo[2.2.1]hept-5-enylmethylideneamino]-2-hydroxybenzamide