| MolName | 2-[2-[(Z)-[[2-(3,6-dioxo-1H-pyridazin-2-yl)acetyl]hydrazinylidene]methyl]phenoxy]acetic acid |
| MolecularFormula | C15H14N4O6 |
| Smiles | OC(COc1c(/C=N\NC(CN(C(C=C2)=O)NC2=O)=O)cccc1)=O |
| InChI | InChI=1S/C15H14N4O6/c20-12-5-6-14(22)19(18-12)8-13(21)17-16-7-10-3-1-2-4-11(10)25-9-15(23)24/h1-7H,8-9H2,(H,17,21)(H,18,20)(H,23,24) |
| InChIK | HAHIVWNEYLZVKH-UHFFFAOYSA-N |
| TotalMolweight | 346.298 |
| Molweight | 346.298 |
| MonoisotopicMass | 346.091336 |
| CLogP | -2.0404 |
| CLogS | -1.983 |
| H Acceptors | 10 |
| H Donors | 3 |
| TotalSurfaceArea | 259.11 |
| Relative PSA | 0.43703 |
| PolarSurfaceArea | 137.4 |
| Druglikeness | 4.7701 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.6 |
| Fragments | 1 |
| Non HAtoms | 25 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 7 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 1 |
| Aromatic Atoms | 6 |
| Sp3Atoms | 4 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-[2-[(Z)-[[2-(3,6-dioxo-1H-pyridazin-2-yl)acetyl]hydrazinylidene]methyl]phenoxy]acetic acid | 2 - 2-[2-[(Z)-[[2-(3,6-dioxo-1H-pyridazin-2-yl)acetyl]hydrazinylidene]methyl]phenoxy]acetic acid