| MolName | 6,8-dichloro-3-[2-[(2Z)-2-[(4-chlorophenyl)methylidene]hydrazinyl]-1,3-thiazol-4-yl]chromen-2-one |
| MolecularFormula | C19H10N3O2Cl3S |
| Smiles | O=C(C(c1csc(N/N=C\c(cc2)ccc2Cl)n1)=Cc1cc(Cl)c2)Oc1c2Cl |
| InChI | InChI=1S/C19H10Cl3N3O2S/c20-12-3-1-10(2-4-12)8-23-25-19-24-16(9-28-19)14-6-11-5-13(21)7-15(22)17(11)27-18(14)26/h1-9H,(H,24,25) |
| InChIK | HAJLDLVGEBCUTK-UHFFFAOYSA-N |
| TotalMolweight | 450.732 |
| Molweight | 450.732 |
| MonoisotopicMass | 448.955928 |
| CLogP | 7.4312 |
| CLogS | -6.825 |
| H Acceptors | 5 |
| H Donors | 1 |
| TotalSurfaceArea | 308.92 |
| Relative PSA | 0.25036 |
| PolarSurfaceArea | 91.82 |
| Druglikeness | 4.3896 |
| Mutagenic | none |
| Tumorigenic | high |
| Reproductive Effective | high |
| Irritant | high |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.60714 |
| Fragments | 1 |
| Non HAtoms | 28 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 4 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 1 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 1 |
| BasicNitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 6,8-dichloro-3-[2-[(2Z)-2-[(4-chlorophenyl)methylidene]hydrazinyl]-1,3-thiazol-4-yl]chromen-2-one | 2 - 6,8-dichloro-3-[2-[(2Z)-2-[(4-chlorophenyl)methylidene]hydrazinyl]-1,3-thiazol-4-yl]chromen-2-one