| MolName | 5-[(Z)-[[2-(2,4-dichlorophenoxy)acetyl]hydrazinylidene]methyl]furan-2-sulfonate |
| MolecularFormula | C13H9N2O6Cl2S |
| Smiles | [O-]S(c1ccc(/C=N\NC(COc(ccc(Cl)c2)c2Cl)=O)o1)(=O)=O |
| InChI | InChI=1S/C13H10Cl2N2O6S/c14-8-1-3-11(10(15)5-8)22-7-12(18)17-16-6-9-2-4-13(23-9)24(19,20)21/h1-6H,7H2,(H,17,18)(H,19,20,21)/p-1 |
| InChIK | HAKPKPMEEGXFLG-UHFFFAOYSA-M |
| TotalMolweight | 392.194 |
| Molweight | 392.194 |
| MonoisotopicMass | 390.955837 |
| CLogP | -0.2023 |
| CLogS | -3.024 |
| H Acceptors | 8 |
| H Donors | 1 |
| TotalSurfaceArea | 267.39 |
| Relative PSA | 0.38513 |
| PolarSurfaceArea | 129.41 |
| Druglikeness | 1.5573 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | high |
| Irritant | high |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.66667 |
| Fragments | 1 |
| Non HAtoms | 24 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 6 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Sp3Atoms | 4 |
| Symmetricatoms | 1 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 5-[(Z)-[[2-(2,4-dichlorophenoxy)acetyl]hydrazinylidene]methyl]furan-2-sulfonate | 2 - 5-[(Z)-[[2-(2,4-dichlorophenoxy)acetyl]hydrazinylidene]methyl]furan-2-sulfonate