| MolName | (Z)-N-[(Z)-(3-iodophenyl)methylideneamino]fluoren-9-imine |
| MolecularFormula | C20H13N2I |
| Smiles | Ic1cc(/C=N\N=C2c(cccc3)c3-c3c2cccc3)ccc1 |
| InChI | InChI=1S/C20H13IN2/c21-15-7-5-6-14(12-15)13-22-23-20-18-10-3-1-8-16(18)17-9-2-4-11-19(17)20/h1-13H |
| InChIK | HANQTVRPUGXKFU-UHFFFAOYSA-N |
| TotalMolweight | 408.237 |
| Molweight | 408.237 |
| MonoisotopicMass | 408.012346 |
| CLogP | 6.8057 |
| CLogS | -7.924 |
| H Acceptors | 2 |
| TotalSurfaceArea | 253.29 |
| Relative PSA | 0.090884 |
| PolarSurfaceArea | 24.72 |
| Druglikeness | 2.5108 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | dimethylene-hydrazine; imine/hydrazone of aldehyde |
| Shape Index | 0.52174 |
| Fragments | 1 |
| Non HAtoms | 23 |
| NonCHAtoms | 3 |
| Electronegative Atoms | 3 |
| Rotatable Bond | 2 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Symmetricatoms | 6 |
| StereoCon |
Click to Load Molecule:
1 - (Z)-N-[(Z)-(3-iodophenyl)methylideneamino]fluoren-9-imine | 2 - (Z)-N-[(Z)-(3-iodophenyl)methylideneamino]fluoren-9-imine