| MolName | [(Z)-[4-(6-cyano-3,5-dioxo-1,2,4-triazin-2-yl)phenyl]methylideneamino]thiourea |
| MolecularFormula | C12H9N7O2S |
| Smiles | NC(N/N=C\c(cc1)ccc1N(C(NC1=O)=O)N=C1C#N)=S |
| InChI | InChI=1S/C12H9N7O2S/c13-5-9-10(20)16-12(21)19(18-9)8-3-1-7(2-4-8)6-15-17-11(14)22/h1-4,6H,(H3,14,17,22)(H,16,20,21) |
| InChIK | HARKBXBNBPTENZ-UHFFFAOYSA-N |
| TotalMolweight | 315.316 |
| Molweight | 315.316 |
| MonoisotopicMass | 315.053843 |
| CLogP | 0.3246 |
| CLogS | -3.664 |
| H Acceptors | 9 |
| H Donors | 3 |
| TotalSurfaceArea | 239.15 |
| Relative PSA | 0.55363 |
| PolarSurfaceArea | 168.06 |
| Druglikeness | 2.4103 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde; thio-amide/urea |
| Shape Index | 0.63636 |
| Fragments | 1 |
| Non HAtoms | 22 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 3 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 1 |
| Aromatic Atoms | 6 |
| Sp3Atoms | 1 |
| Symmetricatoms | 2 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - [(Z)-[4-(6-cyano-3,5-dioxo-1,2,4-triazin-2-yl)phenyl]methylideneamino]thiourea | 2 - [(Z)-[4-(6-cyano-3,5-dioxo-1,2,4-triazin-2-yl)phenyl]methylideneamino]thiourea