| MolName | 2-(5-amino-1,3,4-thiadiazol-2-yl)-N-[(Z)-[5-(3-nitrophenyl)furan-2-yl]methylideneamino]acetamide |
| MolecularFormula | C15H12N6O4S |
| Smiles | Nc1nnc(CC(N/N=C\c2ccc(-c3cc([N+]([O-])=O)ccc3)o2)=O)s1 |
| InChI | InChI=1S/C15H12N6O4S/c16-15-20-19-14(26-15)7-13(22)18-17-8-11-4-5-12(25-11)9-2-1-3-10(6-9)21(23)24/h1-6,8H,7H2,(H2,16,20)(H,18,22) |
| InChIK | HAZROEBHZANSQG-UHFFFAOYSA-N |
| TotalMolweight | 372.364 |
| Molweight | 372.364 |
| MonoisotopicMass | 372.064074 |
| CLogP | 1.3827 |
| CLogS | -4.889 |
| H Acceptors | 10 |
| H Donors | 2 |
| TotalSurfaceArea | 275.85 |
| Relative PSA | 0.50067 |
| PolarSurfaceArea | 180.46 |
| Druglikeness | 2.7093 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.65385 |
| Fragments | 1 |
| Non HAtoms | 26 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 6 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 16 |
| Sp3Atoms | 2 |
| Aromatic Nitrogens | 2 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-(5-amino-1,3,4-thiadiazol-2-yl)-N-[(Z)-[5-(3-nitrophenyl)furan-2-yl]methylideneamino]acetamide | 2 - 2-(5-amino-1,3,4-thiadiazol-2-yl)-N-[(Z)-[5-(3-nitrophenyl)furan-2-yl]methylideneamino]acetamide