| MolName | N-[(Z)-(5-bromothiophen-2-yl)methylideneamino]-2-[[5-[(2-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide |
| MolecularFormula | C16H12N4OBrClS4 |
| Smiles | O=C(CSc1nnc(SCc(cccc2)c2Cl)s1)N/N=C\c(s1)ccc1Br |
| InChI | InChI=1S/C16H12BrClN4OS4/c17-13-6-5-11(26-13)7-19-20-14(23)9-25-16-22-21-15(27-16)24-8-10-3-1-2-4-12(10)18/h1-7H,8-9H2,(H,20,23) |
| InChIK | HBGNQHUKOTVLRN-UHFFFAOYSA-N |
| TotalMolweight | 519.919 |
| Molweight | 519.919 |
| MonoisotopicMass | 517.876579 |
| CLogP | 5.8155 |
| CLogS | -7.937 |
| H Acceptors | 5 |
| H Donors | 1 |
| TotalSurfaceArea | 332.7 |
| Relative PSA | 0.40171 |
| PolarSurfaceArea | 174.32 |
| Druglikeness | 2.7431 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.7037 |
| Fragments | 1 |
| Non HAtoms | 27 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 8 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 16 |
| Sp3Atoms | 4 |
| Aromatic Nitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(5-bromothiophen-2-yl)methylideneamino]-2-[[5-[(2-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide | 2 - N-[(Z)-(5-bromothiophen-2-yl)methylideneamino]-2-[[5-[(2-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide