| MolName | [4-[(Z)-[[4-(4-bromophenyl)-1,3-thiazol-2-yl]hydrazinylidene]methyl]phenyl] 3-nitrobenzoate |
| MolecularFormula | C23H15N4O4BrS |
| Smiles | [O-][N+](c1cccc(C(Oc2ccc(/C=N\Nc3nc(-c(cc4)ccc4Br)cs3)cc2)=O)c1)=O |
| InChI | InChI=1S/C23H15BrN4O4S/c24-18-8-6-16(7-9-18)21-14-33-23(26-21)27-25-13-15-4-10-20(11-5-15)32-22(29)17-2-1-3-19(12-17)28(30)31/h1-14H,(H,26,27) |
| InChIK | HCAUBAFYNQNNDJ-UHFFFAOYSA-N |
| TotalMolweight | 523.366 |
| Molweight | 523.366 |
| MonoisotopicMass | 521.999737 |
| CLogP | 7.2801 |
| CLogS | -7.424 |
| H Acceptors | 8 |
| H Donors | 1 |
| TotalSurfaceArea | 353.51 |
| Relative PSA | 0.30483 |
| PolarSurfaceArea | 137.64 |
| Druglikeness | -3.2369 |
| Mutagenic | none |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde |
| Shape Index | 0.66667 |
| Fragments | 1 |
| Non HAtoms | 33 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 8 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 23 |
| Sp3Atoms | 2 |
| Symmetricatoms | 4 |
| Aromatic Nitrogens | 1 |
| BasicNitrogens | 1 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - [4-[(Z)-[[4-(4-bromophenyl)-1,3-thiazol-2-yl]hydrazinylidene]methyl]phenyl] 3-nitrobenzoate | 2 - [4-[(Z)-[[4-(4-bromophenyl)-1,3-thiazol-2-yl]hydrazinylidene]methyl]phenyl] 3-nitrobenzoate