| MolName | N,N'-bis[(Z)-benzylideneamino]hexanediamide |
| MolecularFormula | C20H22N4O2 |
| Smiles | O=C(CCCCC(N/N=C\c1ccccc1)=O)N/N=C\c1ccccc1 |
| InChI | InChI=1S/C20H22N4O2/c25-19(23-21-15-17-9-3-1-4-10-17)13-7-8-14-20(26)24-22-16-18-11-5-2-6-12-18/h1-6,9-12,15-16H,7-8,13-14H2,(H,23,25)(H,24,26) |
| InChIK | HCIIKBJMNCAZCI-UHFFFAOYSA-N |
| TotalMolweight | 350.421 |
| Molweight | 350.421 |
| MonoisotopicMass | 350.174276 |
| CLogP | 4.356 |
| CLogS | -5.198 |
| H Acceptors | 6 |
| H Donors | 2 |
| TotalSurfaceArea | 296 |
| Relative PSA | 0.24331 |
| PolarSurfaceArea | 82.92 |
| Druglikeness | -4.1295 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.76923 |
| Fragments | 1 |
| Non HAtoms | 26 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 9 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 4 |
| Symmetricatoms | 15 |
| StereoCon |
Click to Load Molecule:
1 - N,N'-bis[(Z)-benzylideneamino]hexanediamide | 2 - N,N'-bis[(Z)-benzylideneamino]hexanediamide