| MolName | [4-nitro-2-[(Z)-[[2-(2-nitrophenoxy)acetyl]hydrazinylidene]methyl]phenyl] 3-bromobenzoate |
| MolecularFormula | C22H15N4O8Br |
| Smiles | [O-][N+](c(cc1)cc(/C=N\NC(COc(cccc2)c2[N+]([O-])=O)=O)c1OC(c1cccc(Br)c1)=O)=O |
| InChI | InChI=1S/C22H15BrN4O8/c23-16-5-3-4-14(10-16)22(29)35-19-9-8-17(26(30)31)11-15(19)12-24-25-21(28)13-34-20-7-2-1-6-18(20)27(32)33/h1-12H,13H2,(H,25,28) |
| InChIK | HCQNBZYPBIRRLU-UHFFFAOYSA-N |
| TotalMolweight | 543.285 |
| Molweight | 543.285 |
| MonoisotopicMass | 542.007327 |
| CLogP | 3.089 |
| CLogS | -6.725 |
| H Acceptors | 12 |
| H Donors | 1 |
| TotalSurfaceArea | 364.23 |
| Relative PSA | 0.35662 |
| PolarSurfaceArea | 168.63 |
| Druglikeness | -2.8759 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.51429 |
| Fragments | 1 |
| Non HAtoms | 35 |
| NonCHAtoms | 13 |
| Electronegative Atoms | 13 |
| Rotatable Bond | 10 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 5 |
| AcidicOxygens | 2 |
| StereoCon |
Click to Load Molecule:
1 - [4-nitro-2-[(Z)-[[2-(2-nitrophenoxy)acetyl]hydrazinylidene]methyl]phenyl] 3-bromobenzoate | 2 - [4-nitro-2-[(Z)-[[2-(2-nitrophenoxy)acetyl]hydrazinylidene]methyl]phenyl] 3-bromobenzoate