| MolName | 2-indol-1-yl-N-[(Z)-2-phenylethylideneamino]acetamide |
| MolecularFormula | C18H17N3O |
| Smiles | O=C(Cn(cc1)c2c1cccc2)N/N=C\Cc1ccccc1 |
| InChI | InChI=1S/C18H17N3O/c22-18(20-19-12-10-15-6-2-1-3-7-15)14-21-13-11-16-8-4-5-9-17(16)21/h1-9,11-13H,10,14H2,(H,20,22) |
| InChIK | HCUNVNKOQIHLKP-UHFFFAOYSA-N |
| TotalMolweight | 291.353 |
| Molweight | 291.353 |
| MonoisotopicMass | 291.137162 |
| CLogP | 2.5556 |
| CLogS | -3.263 |
| H Acceptors | 4 |
| H Donors | 1 |
| TotalSurfaceArea | 238.31 |
| Relative PSA | 0.17993 |
| PolarSurfaceArea | 46.39 |
| Druglikeness | 5.9284 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.68182 |
| Fragments | 1 |
| Non HAtoms | 22 |
| NonCHAtoms | 4 |
| Electronegative Atoms | 4 |
| Rotatable Bond | 5 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 15 |
| Sp3Atoms | 2 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-indol-1-yl-N-[(Z)-2-phenylethylideneamino]acetamide | 2 - 2-indol-1-yl-N-[(Z)-2-phenylethylideneamino]acetamide