| MolName | 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-[4-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-5-(phenoxymethyl)triazole-4-carboxamide |
| MolecularFormula | C26H20N8O4Cl2 |
| Smiles | Nc1nonc1-n1nnc(C(N/N=C\c(cc2)ccc2OCc(ccc(Cl)c2)c2Cl)=O)c1COc1ccccc1 |
| InChI | InChI=1S/C26H20Cl2N8O4/c27-18-9-8-17(21(28)12-18)14-38-20-10-6-16(7-11-20)13-30-32-26(37)23-22(15-39-19-4-2-1-3-5-19)36(35-31-23)25-24(29)33-40-34-25/h1-13H,14-15H2,(H2,29,33)(H,32,37) |
| InChIK | HDKIIQWGVSEXOI-UHFFFAOYSA-N |
| TotalMolweight | 579.403 |
| Molweight | 579.403 |
| MonoisotopicMass | 578.098456 |
| CLogP | 5.6576 |
| CLogS | -5.606 |
| H Acceptors | 12 |
| H Donors | 2 |
| TotalSurfaceArea | 427.08 |
| Relative PSA | 0.31877 |
| PolarSurfaceArea | 155.57 |
| Druglikeness | 1.7579 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.575 |
| Fragments | 1 |
| Non HAtoms | 40 |
| NonCHAtoms | 14 |
| Electronegative Atoms | 14 |
| Rotatable Bond | 10 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 5 |
| Aromatic Atoms | 28 |
| Sp3Atoms | 4 |
| Symmetricatoms | 4 |
| Aromatic Nitrogens | 5 |
| StereoCon |
Click to Load Molecule:
1 - 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-[4-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-5-(phenoxymethyl)triazole-4-carboxamide | 2 - 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-[4-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-5-(phenoxymethyl)triazole-4-carboxamide