| MolName | 1-[(Z)-[(E)-3-phenylprop-2-enylidene]amino]tetrazol-5-amine |
| MolecularFormula | C10H10N6 |
| Smiles | Nc1nnnn1/N=C\C=C\c1ccccc1 |
| InChI | InChI=1S/C10H10N6/c11-10-13-14-15-16(10)12-8-4-7-9-5-2-1-3-6-9/h1-8H,(H2,11,13,15) |
| InChIK | HDMYUEYNNGDXBK-UHFFFAOYSA-N |
| TotalMolweight | 214.231 |
| Molweight | 214.231 |
| MonoisotopicMass | 214.096694 |
| CLogP | 1.2448 |
| CLogS | -4.079 |
| H Acceptors | 6 |
| H Donors | 1 |
| TotalSurfaceArea | 178.28 |
| Relative PSA | 0.37335 |
| PolarSurfaceArea | 81.98 |
| Druglikeness | 1.3456 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.6875 |
| Fragments | 1 |
| Non HAtoms | 16 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 3 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 4 |
| StereoCon |
Click to Load Molecule:
1 - 1-[(Z)-[(E)-3-phenylprop-2-enylidene]amino]tetrazol-5-amine | 2 - 1-[(Z)-[(E)-3-phenylprop-2-enylidene]amino]tetrazol-5-amine