| MolName | (Z)-N-[4-[(2-chlorophenyl)methyl]piperazin-4-ium-1-yl]-1-(4-phenylmethoxyphenyl)methanimine |
| MolecularFormula | C25H27N3OCl |
| Smiles | Clc1c(C[NH+](CC2)CCN2/N=C\c(cc2)ccc2OCc2ccccc2)cccc1 |
| InChI | InChI=1S/C25H26ClN3O/c26-25-9-5-4-8-23(25)19-28-14-16-29(17-15-28)27-18-21-10-12-24(13-11-21)30-20-22-6-2-1-3-7-22/h1-13,18H,14-17,19-20H2/p+1 |
| InChIK | HEKBRBDMBAWBPV-UHFFFAOYSA-O |
| TotalMolweight | 420.962 |
| Molweight | 420.962 |
| MonoisotopicMass | 420.184264 |
| CLogP | 2.8634 |
| CLogS | -4.733 |
| H Acceptors | 4 |
| H Donors | 1 |
| TotalSurfaceArea | 346.66 |
| Relative PSA | 0.12303 |
| PolarSurfaceArea | 29.27 |
| Druglikeness | 3.2955 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.7 |
| Fragments | 1 |
| Non HAtoms | 30 |
| NonCHAtoms | 5 |
| Electronegative Atoms | 5 |
| Rotatable Bond | 7 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 9 |
| Symmetricatoms | 6 |
| Amines | 1 |
| AlkylAmines | 1 |
| BasicNitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - (Z)-N-[4-[(2-chlorophenyl)methyl]piperazin-4-ium-1-yl]-1-(4-phenylmethoxyphenyl)methanimine | 2 - (Z)-N-[4-[(2-chlorophenyl)methyl]piperazin-4-ium-1-yl]-1-(4-phenylmethoxyphenyl)methanimine