| MolName | N-[(Z)-3-[(2Z)-2-[(E)-3-(2-chlorophenyl)prop-2-enylidene]hydrazinyl]-3-oxo-1-thiophen-2-ylprop-1-en-2-yl]benzamide |
| MolecularFormula | C23H18N3O2ClS |
| Smiles | O=C(/C(/NC(c1ccccc1)=O)=C/c1cccs1)N/N=C\C=C\c(cccc1)c1Cl |
| InChI | InChI=1S/C23H18ClN3O2S/c24-20-13-5-4-8-17(20)11-6-14-25-27-23(29)21(16-19-12-7-15-30-19)26-22(28)18-9-2-1-3-10-18/h1-16H,(H,26,28)(H,27,29) |
| InChIK | HFAINBDPIYPXCF-UHFFFAOYSA-N |
| TotalMolweight | 435.934 |
| Molweight | 435.934 |
| MonoisotopicMass | 435.080824 |
| CLogP | 5.3092 |
| CLogS | -6.504 |
| H Acceptors | 5 |
| H Donors | 2 |
| TotalSurfaceArea | 338.53 |
| Relative PSA | 0.23889 |
| PolarSurfaceArea | 98.8 |
| Druglikeness | 7.6185 |
| Mutagenic | none |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.56667 |
| Fragments | 1 |
| Non HAtoms | 30 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 7 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Symmetricatoms | 2 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-3-[(2Z)-2-[(E)-3-(2-chlorophenyl)prop-2-enylidene]hydrazinyl]-3-oxo-1-thiophen-2-ylprop-1-en-2-yl]benzamide | 2 - N-[(Z)-3-[(2Z)-2-[(E)-3-(2-chlorophenyl)prop-2-enylidene]hydrazinyl]-3-oxo-1-thiophen-2-ylprop-1-en-2-yl]benzamide