| MolName | (3R)-N-[(Z)-[(E)-3-(1,3-benzodioxol-5-yl)prop-2-enylidene]amino]-2,3-dihydro-1,4-benzodioxine-3-carboxamide |
| MolecularFormula | C19H16N2O5 |
| Smiles | O=C([C@@H]1Oc(cccc2)c2OC1)N/N=C\C=C\c(cc1)cc2c1OCO2 |
| InChI | InChI=1S/C19H16N2O5/c22-19(18-11-23-14-5-1-2-6-16(14)26-18)21-20-9-3-4-13-7-8-15-17(10-13)25-12-24-15/h1-10,18H,11-12H2,(H,21,22)/t18-/m1/s1 |
| InChIK | HFDXFUZRSIKREF-GOSISDBHSA-N |
| TotalMolweight | 352.345 |
| Molweight | 352.345 |
| MonoisotopicMass | 352.105923 |
| CLogP | 2.8734 |
| CLogS | -4.746 |
| H Acceptors | 7 |
| H Donors | 1 |
| TotalSurfaceArea | 266.51 |
| Relative PSA | 0.28521 |
| PolarSurfaceArea | 78.38 |
| Druglikeness | 4.9746 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.65385 |
| Fragments | 1 |
| Non HAtoms | 26 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| StereoCenters | 1 |
| Rotatable Bond | 4 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 7 |
| StereoCon | this enantiomer |
Click to Load Molecule:
1 - (3R)-N-[(Z)-[(E)-3-(1,3-benzodioxol-5-yl)prop-2-enylidene]amino]-2,3-dihydro-1,4-benzodioxine-3-carboxamide | 2 - (3R)-N-[(Z)-[(E)-3-(1,3-benzodioxol-5-yl)prop-2-enylidene]amino]-2,3-dihydro-1,4-benzodioxine-3-carboxamide