| MolName | [4-bromo-2-[(Z)-[[2-[(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]-2-oxoacetyl]hydrazinylidene]methyl]phenyl] 2-chlorobenzoate |
| MolecularFormula | C25H18N4O4BrClS |
| Smiles | N#Cc1c(NC(C(N/N=C\c(cc(cc2)Br)c2OC(c(cccc2)c2Cl)=O)=O)=O)sc2c1CCCC2 |
| InChI | InChI=1S/C25H18BrClN4O4S/c26-15-9-10-20(35-25(34)17-6-1-3-7-19(17)27)14(11-15)13-29-31-23(33)22(32)30-24-18(12-28)16-5-2-4-8-21(16)36-24/h1,3,6-7,9-11,13H,2,4-5,8H2,(H,30,32)(H,31,33) |
| InChIK | HFGDNSUDMWMFJR-UHFFFAOYSA-N |
| TotalMolweight | 585.865 |
| Molweight | 585.865 |
| MonoisotopicMass | 583.992064 |
| CLogP | 5.9542 |
| CLogS | -8.59 |
| H Acceptors | 8 |
| H Donors | 2 |
| TotalSurfaceArea | 396.95 |
| Relative PSA | 0.29593 |
| PolarSurfaceArea | 148.89 |
| Druglikeness | -6.2222 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde; limit! oxal-diamide |
| Shape Index | 0.52778 |
| Fragments | 1 |
| Non HAtoms | 36 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 7 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 5 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - [4-bromo-2-[(Z)-[[2-[(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]-2-oxoacetyl]hydrazinylidene]methyl]phenyl] 2-chlorobenzoate | 2 - [4-bromo-2-[(Z)-[[2-[(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]-2-oxoacetyl]hydrazinylidene]methyl]phenyl] 2-chlorobenzoate