| MolName | (2Z)-2-[(3-hydroxyphenyl)hydrazinylidene]-1-(3-nitrophenyl)ethanone |
| MolecularFormula | C14H11N3O4 |
| Smiles | [O-][N+](c1cc(C(/C=N\Nc2cc(O)ccc2)=O)ccc1)=O |
| InChI | InChI=1S/C14H11N3O4/c18-13-6-2-4-11(8-13)16-15-9-14(19)10-3-1-5-12(7-10)17(20)21/h1-9,16,18H |
| InChIK | HFRPLVGTEPCARJ-UHFFFAOYSA-N |
| TotalMolweight | 285.258 |
| Molweight | 285.258 |
| MonoisotopicMass | 285.074957 |
| CLogP | 2.3725 |
| CLogS | -3.381 |
| H Acceptors | 7 |
| H Donors | 2 |
| TotalSurfaceArea | 217.01 |
| Relative PSA | 0.36648 |
| PolarSurfaceArea | 107.51 |
| Druglikeness | -2.7467 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde |
| Shape Index | 0.61905 |
| Fragments | 1 |
| Non HAtoms | 21 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 5 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 2 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - (2Z)-2-[(3-hydroxyphenyl)hydrazinylidene]-1-(3-nitrophenyl)ethanone | 2 - (2Z)-2-[(3-hydroxyphenyl)hydrazinylidene]-1-(3-nitrophenyl)ethanone