| MolName | 4-chloro-N-[2-[(2Z)-2-[[5-(4-iodophenyl)furan-2-yl]methylidene]hydrazinyl]-2-oxoethyl]benzamide |
| MolecularFormula | C20H15N3O3ClI |
| Smiles | O=C(CNC(c(cc1)ccc1Cl)=O)N/N=C\c1ccc(-c(cc2)ccc2I)o1 |
| InChI | InChI=1S/C20H15ClIN3O3/c21-15-5-1-14(2-6-15)20(27)23-12-19(26)25-24-11-17-9-10-18(28-17)13-3-7-16(22)8-4-13/h1-11H,12H2,(H,23,27)(H,25,26) |
| InChIK | HFVNEKLCTSOPMO-UHFFFAOYSA-N |
| TotalMolweight | 507.71 |
| Molweight | 507.71 |
| MonoisotopicMass | 506.984667 |
| CLogP | 4.2673 |
| CLogS | -6.7 |
| H Acceptors | 6 |
| H Donors | 2 |
| TotalSurfaceArea | 321.11 |
| Relative PSA | 0.23238 |
| PolarSurfaceArea | 83.7 |
| Druglikeness | 7.7198 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.71429 |
| Fragments | 1 |
| Non HAtoms | 28 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 6 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 1 |
| Symmetricatoms | 4 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - 4-chloro-N-[2-[(2Z)-2-[[5-(4-iodophenyl)furan-2-yl]methylidene]hydrazinyl]-2-oxoethyl]benzamide | 2 - 4-chloro-N-[2-[(2Z)-2-[[5-(4-iodophenyl)furan-2-yl]methylidene]hydrazinyl]-2-oxoethyl]benzamide