| MolName | 3-[5-[(Z)-[[2-(5-amino-1,3,4-thiadiazol-2-yl)acetyl]hydrazinylidene]methyl]furan-2-yl]benzoate |
| MolecularFormula | C16H12N5O4S |
| Smiles | Nc1nnc(CC(N/N=C\c2ccc(-c3cc(C([O-])=O)ccc3)o2)=O)s1 |
| InChI | InChI=1S/C16H13N5O4S/c17-16-21-20-14(26-16)7-13(22)19-18-8-11-4-5-12(25-11)9-2-1-3-10(6-9)15(23)24/h1-6,8H,7H2,(H2,17,21)(H,19,22)(H,23,24)/p-1 |
| InChIK | HGSIBOXUPUVKGY-UHFFFAOYSA-M |
| TotalMolweight | 370.368 |
| Molweight | 370.368 |
| MonoisotopicMass | 370.061 |
| CLogP | -0.2866 |
| CLogS | -4.442 |
| H Acceptors | 9 |
| H Donors | 2 |
| TotalSurfaceArea | 277.46 |
| Relative PSA | 0.48659 |
| PolarSurfaceArea | 174.77 |
| Druglikeness | 7.8072 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.65385 |
| Fragments | 1 |
| Non HAtoms | 26 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 6 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 16 |
| Sp3Atoms | 2 |
| Aromatic Nitrogens | 2 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 3-[5-[(Z)-[[2-(5-amino-1,3,4-thiadiazol-2-yl)acetyl]hydrazinylidene]methyl]furan-2-yl]benzoate | 2 - 3-[5-[(Z)-[[2-(5-amino-1,3,4-thiadiazol-2-yl)acetyl]hydrazinylidene]methyl]furan-2-yl]benzoate