| MolName | 3,4-dichloro-N-[(Z)-(2,6-dichlorophenyl)methylideneamino]benzamide |
| MolecularFormula | C14H8N2OCl4 |
| Smiles | O=C(c(cc1)cc(Cl)c1Cl)N/N=C\c(c(Cl)ccc1)c1Cl |
| InChI | InChI=1S/C14H8Cl4N2O/c15-10-2-1-3-11(16)9(10)7-19-20-14(21)8-4-5-12(17)13(18)6-8/h1-7H,(H,20,21) |
| InChIK | HGVHKKAOAMQODH-UHFFFAOYSA-N |
| TotalMolweight | 362.043 |
| Molweight | 362.043 |
| MonoisotopicMass | 359.939071 |
| CLogP | 5.6256 |
| CLogS | -6.665 |
| H Acceptors | 3 |
| H Donors | 1 |
| TotalSurfaceArea | 248.67 |
| Relative PSA | 0.14481 |
| PolarSurfaceArea | 41.46 |
| Druglikeness | 4.4715 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | low |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.61905 |
| Fragments | 1 |
| Non HAtoms | 21 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 3 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Symmetricatoms | 3 |
| StereoCon |
Click to Load Molecule:
1 - 3,4-dichloro-N-[(Z)-(2,6-dichlorophenyl)methylideneamino]benzamide | 2 - 3,4-dichloro-N-[(Z)-(2,6-dichlorophenyl)methylideneamino]benzamide