| MolName | N-[(Z)-[1-[(2-fluorophenyl)methyl]indol-3-yl]methylideneamino]-1H-benzimidazol-2-amine |
| MolecularFormula | C23H18N5F |
| Smiles | Fc1c(Cn2c(cccc3)c3c(/C=N\Nc3nc(cccc4)c4[nH]3)c2)cccc1 |
| InChI | InChI=1S/C23H18FN5/c24-19-9-3-1-7-16(19)14-29-15-17(18-8-2-6-12-22(18)29)13-25-28-23-26-20-10-4-5-11-21(20)27-23/h1-13,15H,14H2,(H2,26,27,28) |
| InChIK | HGVYPOOHLXWFST-UHFFFAOYSA-N |
| TotalMolweight | 383.429 |
| Molweight | 383.429 |
| MonoisotopicMass | 383.154623 |
| CLogP | 6.4405 |
| CLogS | -4.923 |
| H Acceptors | 5 |
| H Donors | 2 |
| TotalSurfaceArea | 295.84 |
| Relative PSA | 0.18524 |
| PolarSurfaceArea | 58 |
| Druglikeness | 3.7626 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.55172 |
| Fragments | 1 |
| Non HAtoms | 29 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 5 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 5 |
| Aromatic Atoms | 24 |
| Sp3Atoms | 1 |
| Aromatic Nitrogens | 3 |
| BasicNitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-[1-[(2-fluorophenyl)methyl]indol-3-yl]methylideneamino]-1H-benzimidazol-2-amine | 2 - N-[(Z)-[1-[(2-fluorophenyl)methyl]indol-3-yl]methylideneamino]-1H-benzimidazol-2-amine