| MolName | N-[(Z)-[1-[(2,4-dichlorophenyl)methyl]indol-3-yl]methylideneamino]-3-nitrobenzamide |
| MolecularFormula | C23H16N4O3Cl2 |
| Smiles | [O-][N+](c1cccc(C(N/N=C\c2cn(Cc(ccc(Cl)c3)c3Cl)c3c2cccc3)=O)c1)=O |
| InChI | InChI=1S/C23H16Cl2N4O3/c24-18-9-8-16(21(25)11-18)13-28-14-17(20-6-1-2-7-22(20)28)12-26-27-23(30)15-4-3-5-19(10-15)29(31)32/h1-12,14H,13H2,(H,27,30) |
| InChIK | HGZAMDMMYUCXIF-UHFFFAOYSA-N |
| TotalMolweight | 467.311 |
| Molweight | 467.311 |
| MonoisotopicMass | 466.059945 |
| CLogP | 5.0217 |
| CLogS | -6.631 |
| H Acceptors | 7 |
| H Donors | 1 |
| TotalSurfaceArea | 338.82 |
| Relative PSA | 0.21634 |
| PolarSurfaceArea | 92.21 |
| Druglikeness | 1.0157 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.5625 |
| Fragments | 1 |
| Non HAtoms | 32 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 6 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 21 |
| Sp3Atoms | 2 |
| Aromatic Nitrogens | 1 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-[1-[(2,4-dichlorophenyl)methyl]indol-3-yl]methylideneamino]-3-nitrobenzamide | 2 - N-[(Z)-[1-[(2,4-dichlorophenyl)methyl]indol-3-yl]methylideneamino]-3-nitrobenzamide