| MolName | 4-chloro-N-[(Z)-[3-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-phenylpyrazol-4-yl]methylideneamino]benzamide |
| MolecularFormula | C25H19N4O3Cl |
| Smiles | O=C(c(cc1)ccc1Cl)N/N=C\c1cn(-c2ccccc2)nc1-c(cc1)cc2c1OCCO2 |
| InChI | InChI=1S/C25H19ClN4O3/c26-20-9-6-17(7-10-20)25(31)28-27-15-19-16-30(21-4-2-1-3-5-21)29-24(19)18-8-11-22-23(14-18)33-13-12-32-22/h1-11,14-16H,12-13H2,(H,28,31) |
| InChIK | HHAZDYOZDUINED-UHFFFAOYSA-N |
| TotalMolweight | 458.904 |
| Molweight | 458.904 |
| MonoisotopicMass | 458.114568 |
| CLogP | 4.7054 |
| CLogS | -6.152 |
| H Acceptors | 7 |
| H Donors | 1 |
| TotalSurfaceArea | 343.91 |
| Relative PSA | 0.21474 |
| PolarSurfaceArea | 77.74 |
| Druglikeness | -1.2971 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.51515 |
| Fragments | 1 |
| Non HAtoms | 33 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 5 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 23 |
| Sp3Atoms | 4 |
| Symmetricatoms | 4 |
| Aromatic Nitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - 4-chloro-N-[(Z)-[3-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-phenylpyrazol-4-yl]methylideneamino]benzamide | 2 - 4-chloro-N-[(Z)-[3-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-phenylpyrazol-4-yl]methylideneamino]benzamide