| MolName | (2E)-2-[(E)-(2,6-difluorophenyl)methylidenehydrazinylidene]-1,2-diphenylethanone |
| MolecularFormula | C21H14N2OF2 |
| Smiles | O=C(/C(/c1ccccc1)=N/N=C/c(c(F)ccc1)c1F)c1ccccc1 |
| InChI | InChI=1S/C21H14F2N2O/c22-18-12-7-13-19(23)17(18)14-24-25-20(15-8-3-1-4-9-15)21(26)16-10-5-2-6-11-16/h1-14H |
| InChIK | HHDXTHIYYFHDJK-UHFFFAOYSA-N |
| TotalMolweight | 348.351 |
| Molweight | 348.351 |
| MonoisotopicMass | 348.107419 |
| CLogP | 5.4787 |
| CLogS | -6.436 |
| H Acceptors | 3 |
| TotalSurfaceArea | 270.96 |
| Relative PSA | 0.13308 |
| PolarSurfaceArea | 41.79 |
| Druglikeness | 1.4572 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | dimethylene-hydrazine; imine/hydrazone of aldehyde |
| Shape Index | 0.5 |
| Fragments | 1 |
| Non HAtoms | 26 |
| NonCHAtoms | 5 |
| Electronegative Atoms | 5 |
| Rotatable Bond | 5 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Symmetricatoms | 7 |
| StereoCon |
Click to Load Molecule:
1 - (2E)-2-[(E)-(2,6-difluorophenyl)methylidenehydrazinylidene]-1,2-diphenylethanone | 2 - (2E)-2-[(E)-(2,6-difluorophenyl)methylidenehydrazinylidene]-1,2-diphenylethanone