| MolName | N-[(Z)-(4-phenylmethoxyphenyl)methylideneamino]-1-benzofuran-2-carboxamide |
| MolecularFormula | C23H18N2O3 |
| Smiles | O=C(c1cc(cccc2)c2o1)N/N=C\c(cc1)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C23H18N2O3/c26-23(22-14-19-8-4-5-9-21(19)28-22)25-24-15-17-10-12-20(13-11-17)27-16-18-6-2-1-3-7-18/h1-15H,16H2,(H,25,26) |
| InChIK | HJABDTQKDPNPFZ-UHFFFAOYSA-N |
| TotalMolweight | 370.407 |
| Molweight | 370.407 |
| MonoisotopicMass | 370.131743 |
| CLogP | 5.0553 |
| CLogS | -6.245 |
| H Acceptors | 5 |
| H Donors | 1 |
| TotalSurfaceArea | 294.8 |
| Relative PSA | 0.20393 |
| PolarSurfaceArea | 63.83 |
| Druglikeness | 4.4767 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.67857 |
| Fragments | 1 |
| Non HAtoms | 28 |
| NonCHAtoms | 5 |
| Electronegative Atoms | 5 |
| Rotatable Bond | 6 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 21 |
| Sp3Atoms | 2 |
| Symmetricatoms | 4 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(4-phenylmethoxyphenyl)methylideneamino]-1-benzofuran-2-carboxamide | 2 - N-[(Z)-(4-phenylmethoxyphenyl)methylideneamino]-1-benzofuran-2-carboxamide