| MolName | 2,4-dinitro-N-[(Z)-[2-(2-phenylethynyl)cyclohexen-1-yl]methylideneamino]aniline |
| MolecularFormula | C21H18N4O4 |
| Smiles | [O-][N+](c(cc1)cc([N+]([O-])=O)c1N/N=C\C(CCCC1)=C1C#Cc1ccccc1)=O |
| InChI | InChI=1S/C21H18N4O4/c26-24(27)19-12-13-20(21(14-19)25(28)29)23-22-15-18-9-5-4-8-17(18)11-10-16-6-2-1-3-7-16/h1-3,6-7,12-15,23H,4-5,8-9H2 |
| InChIK | HJALSCRBLBLRPI-UHFFFAOYSA-N |
| TotalMolweight | 390.398 |
| Molweight | 390.398 |
| MonoisotopicMass | 390.132806 |
| CLogP | 4.6265 |
| CLogS | -5.934 |
| H Acceptors | 8 |
| H Donors | 1 |
| TotalSurfaceArea | 310.84 |
| Relative PSA | 0.26962 |
| PolarSurfaceArea | 116.03 |
| Druglikeness | -11.649 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde |
| Shape Index | 0.58621 |
| Fragments | 1 |
| Non HAtoms | 29 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 6 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 6 |
| Symmetricatoms | 2 |
| AcidicOxygens | 2 |
| StereoCon |
Click to Load Molecule:
1 - 2,4-dinitro-N-[(Z)-[2-(2-phenylethynyl)cyclohexen-1-yl]methylideneamino]aniline | 2 - 2,4-dinitro-N-[(Z)-[2-(2-phenylethynyl)cyclohexen-1-yl]methylideneamino]aniline