| MolName | 1-[(Z)-(3,4-dichlorophenyl)methylideneamino]-3-[(3R)-1,1-dioxothiolan-3-yl]thiourea |
| MolecularFormula | C12H13N3O2Cl2S2 |
| Smiles | O=S(CC1)(C[C@@H]1NC(N/N=C\c(cc1)cc(Cl)c1Cl)=S)=O |
| InChI | InChI=1S/C12H13Cl2N3O2S2/c13-10-2-1-8(5-11(10)14)6-15-17-12(20)16-9-3-4-21(18,19)7-9/h1-2,5-6,9H,3-4,7H2,(H2,16,17,20)/t9-/m1/s1 |
| InChIK | HJMBIOQFNYONCM-SECBINFHSA-N |
| TotalMolweight | 366.292 |
| Molweight | 366.292 |
| MonoisotopicMass | 364.982621 |
| CLogP | 2.4592 |
| CLogS | -4.83 |
| H Acceptors | 5 |
| H Donors | 2 |
| TotalSurfaceArea | 253.35 |
| Relative PSA | 0.35923 |
| PolarSurfaceArea | 111.03 |
| Druglikeness | 0.12245 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde; thio-amide/urea |
| Shape Index | 0.66667 |
| Fragments | 1 |
| Non HAtoms | 21 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| StereoCenters | 1 |
| Rotatable Bond | 3 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 1 |
| Aromatic Atoms | 6 |
| Sp3Atoms | 6 |
| Symmetricatoms | 1 |
| StereoCon | this enantiomer |
Click to Load Molecule:
1 - 1-[(Z)-(3,4-dichlorophenyl)methylideneamino]-3-[(3R)-1,1-dioxothiolan-3-yl]thiourea | 2 - 1-[(Z)-(3,4-dichlorophenyl)methylideneamino]-3-[(3R)-1,1-dioxothiolan-3-yl]thiourea