| MolName | 1-(1-adamantyl)-3-[(Z)-pyridin-4-ylmethylideneamino]urea |
| MolecularFormula | C17H22N4O |
| Smiles | O=C(NC1(CC(C2)C3)CC3CC2C1)N/N=C\c1ccncc1 |
| InChI | InChI=1S/C17H22N4O/c22-16(21-19-11-12-1-3-18-4-2-12)20-17-8-13-5-14(9-17)7-15(6-13)10-17/h1-4,11,13-15H,5-10H2,(H2,20,21,22) |
| InChIK | HKOKBNLEHUVQNP-UHFFFAOYSA-N |
| TotalMolweight | 298.389 |
| Molweight | 298.389 |
| MonoisotopicMass | 298.179361 |
| CLogP | 2.5611 |
| CLogS | -4.27 |
| H Acceptors | 5 |
| H Donors | 2 |
| TotalSurfaceArea | 227.42 |
| Relative PSA | 0.25697 |
| PolarSurfaceArea | 66.38 |
| Druglikeness | 4.6327 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.59091 |
| Fragments | 1 |
| Non HAtoms | 22 |
| NonCHAtoms | 5 |
| Electronegative Atoms | 5 |
| Rotatable Bond | 3 |
| Rings Closures | 4 |
| Small Rings | 5 |
| Aromatic Rings | 1 |
| Aromatic Atoms | 6 |
| Sp3Atoms | 10 |
| Symmetricatoms | 8 |
| Amides | 1 |
| Aromatic Nitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 1-(1-adamantyl)-3-[(Z)-pyridin-4-ylmethylideneamino]urea | 2 - 1-(1-adamantyl)-3-[(Z)-pyridin-4-ylmethylideneamino]urea