| MolName | 4-[(Z)-[(2-fluorobenzoyl)hydrazinylidene]methyl]benzoic acid |
| MolecularFormula | C15H11N2O3F |
| Smiles | OC(c1ccc(/C=N\NC(c(cccc2)c2F)=O)cc1)=O |
| InChI | InChI=1S/C15H11FN2O3/c16-13-4-2-1-3-12(13)14(19)18-17-9-10-5-7-11(8-6-10)15(20)21/h1-9H,(H,18,19)(H,20,21) |
| InChIK | HKOKGPWMHVUFQJ-UHFFFAOYSA-N |
| TotalMolweight | 286.261 |
| Molweight | 286.261 |
| MonoisotopicMass | 286.075371 |
| CLogP | 2.7875 |
| CLogS | -4.048 |
| H Acceptors | 5 |
| H Donors | 2 |
| TotalSurfaceArea | 217.44 |
| Relative PSA | 0.28583 |
| PolarSurfaceArea | 78.76 |
| Druglikeness | 2.8225 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.66667 |
| Fragments | 1 |
| Non HAtoms | 21 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 4 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 1 |
| Symmetricatoms | 2 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 4-[(Z)-[(2-fluorobenzoyl)hydrazinylidene]methyl]benzoic acid | 2 - 4-[(Z)-[(2-fluorobenzoyl)hydrazinylidene]methyl]benzoic acid