| MolName | N-[(Z)-[(Z)-3-(furan-2-yl)prop-2-enylidene]amino]furan-2-carboxamide |
| MolecularFormula | C12H10N2O3 |
| Smiles | O=C(c1ccco1)N/N=C\C=C/c1ccco1 |
| InChI | InChI=1S/C12H10N2O3/c15-12(11-6-3-9-17-11)14-13-7-1-4-10-5-2-8-16-10/h1-9H,(H,14,15) |
| InChIK | HLGKWQNSSHVFBQ-UHFFFAOYSA-N |
| TotalMolweight | 230.222 |
| Molweight | 230.222 |
| MonoisotopicMass | 230.069143 |
| CLogP | 1.5973 |
| CLogS | -3.377 |
| H Acceptors | 5 |
| H Donors | 1 |
| TotalSurfaceArea | 192.87 |
| Relative PSA | 0.33302 |
| PolarSurfaceArea | 67.74 |
| Druglikeness | 4.4025 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.70588 |
| Fragments | 1 |
| Non HAtoms | 17 |
| NonCHAtoms | 5 |
| Electronegative Atoms | 5 |
| Rotatable Bond | 4 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 10 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-[(Z)-3-(furan-2-yl)prop-2-enylidene]amino]furan-2-carboxamide | 2 - N-[(Z)-[(Z)-3-(furan-2-yl)prop-2-enylidene]amino]furan-2-carboxamide