| MolName | [(Z)-[4-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]urea |
| MolecularFormula | C15H13N3O2Cl2 |
| Smiles | NC(N/N=C\c(cc1)ccc1OCc(ccc(Cl)c1)c1Cl)=O |
| InChI | InChI=1S/C15H13Cl2N3O2/c16-12-4-3-11(14(17)7-12)9-22-13-5-1-10(2-6-13)8-19-20-15(18)21/h1-8H,9H2,(H3,18,20,21) |
| InChIK | HLGUTSKPZYKPPM-UHFFFAOYSA-N |
| TotalMolweight | 338.193 |
| Molweight | 338.193 |
| MonoisotopicMass | 337.038481 |
| CLogP | 3.6954 |
| CLogS | -5.627 |
| H Acceptors | 5 |
| H Donors | 2 |
| TotalSurfaceArea | 250.11 |
| Relative PSA | 0.24501 |
| PolarSurfaceArea | 76.71 |
| Druglikeness | 3.9275 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.72727 |
| Fragments | 1 |
| Non HAtoms | 22 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 5 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 2 |
| Symmetricatoms | 2 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - [(Z)-[4-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]urea | 2 - [(Z)-[4-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]urea