| MolName | 3-[4-[(Z)-(2,4-dichlorophenyl)methylideneamino]-5-oxo-3-sulfanylidene-2H-1,2,4-triazin-6-yl]propanoic acid |
| MolecularFormula | C13H10N4O3Cl2S |
| Smiles | OC(CCC(C(N1/N=C\c(ccc(Cl)c2)c2Cl)=O)=NNC1=S)=O |
| InChI | InChI=1S/C13H10Cl2N4O3S/c14-8-2-1-7(9(15)5-8)6-16-19-12(22)10(3-4-11(20)21)17-18-13(19)23/h1-2,5-6H,3-4H2,(H,18,23)(H,20,21) |
| InChIK | HLOYHHJAINEURT-UHFFFAOYSA-N |
| TotalMolweight | 373.219 |
| Molweight | 373.219 |
| MonoisotopicMass | 371.985065 |
| CLogP | 2.3546 |
| CLogS | -4.69 |
| H Acceptors | 7 |
| H Donors | 2 |
| TotalSurfaceArea | 262.17 |
| Relative PSA | 0.4013 |
| PolarSurfaceArea | 126.45 |
| Druglikeness | 4.2564 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde; thio-amide/urea |
| Shape Index | 0.6087 |
| Fragments | 1 |
| Non HAtoms | 23 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 5 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 1 |
| Aromatic Atoms | 6 |
| Sp3Atoms | 4 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 3-[4-[(Z)-(2,4-dichlorophenyl)methylideneamino]-5-oxo-3-sulfanylidene-2H-1,2,4-triazin-6-yl]propanoic acid | 2 - 3-[4-[(Z)-(2,4-dichlorophenyl)methylideneamino]-5-oxo-3-sulfanylidene-2H-1,2,4-triazin-6-yl]propanoic acid