| MolName | 4-N-benzyl-2-N-[(Z)-(2,4-dichlorophenyl)methylideneamino]-6-morpholin-4-yl-1,3,5-triazine-2,4-diamine |
| MolecularFormula | C21H21N7OCl2 |
| Smiles | Clc1cc(Cl)c(/C=N\Nc2nc(N3CCOCC3)nc(NCc3ccccc3)n2)cc1 |
| InChI | InChI=1S/C21H21Cl2N7O/c22-17-7-6-16(18(23)12-17)14-25-29-20-26-19(24-13-15-4-2-1-3-5-15)27-21(28-20)30-8-10-31-11-9-30/h1-7,12,14H,8-11,13H2,(H2,24,26,27,28,29) |
| InChIK | HLVODIAZXVFOBI-UHFFFAOYSA-N |
| TotalMolweight | 458.352 |
| Molweight | 458.352 |
| MonoisotopicMass | 457.118462 |
| CLogP | 6.2086 |
| CLogS | -6.293 |
| H Acceptors | 8 |
| H Donors | 2 |
| TotalSurfaceArea | 343.18 |
| Relative PSA | 0.23571 |
| PolarSurfaceArea | 87.56 |
| Druglikeness | 3.5079 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | high |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.54839 |
| Fragments | 1 |
| Non HAtoms | 31 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 7 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 6 |
| Symmetricatoms | 4 |
| Aromatic Nitrogens | 3 |
| BasicNitrogens | 3 |
| StereoCon |
Click to Load Molecule:
1 - 4-N-benzyl-2-N-[(Z)-(2,4-dichlorophenyl)methylideneamino]-6-morpholin-4-yl-1,3,5-triazine-2,4-diamine | 2 - 4-N-benzyl-2-N-[(Z)-(2,4-dichlorophenyl)methylideneamino]-6-morpholin-4-yl-1,3,5-triazine-2,4-diamine