| MolName | (Z)-[(3Z)-3-[(4-chlorophenyl)methylidene]-2-morpholin-4-ylcyclopenten-1-yl]methylidenehydrazine |
| MolecularFormula | C17H20N3OCl |
| Smiles | N/N=C\C(CC/C1=C/c(cc2)ccc2Cl)=C1N1CCOCC1 |
| InChI | InChI=1S/C17H20ClN3O/c18-16-5-1-13(2-6-16)11-14-3-4-15(12-20-19)17(14)21-7-9-22-10-8-21/h1-2,5-6,11-12H,3-4,7-10,19H2 |
| InChIK | HLVQASGOBVEBLJ-UHFFFAOYSA-N |
| TotalMolweight | 317.819 |
| Molweight | 317.819 |
| MonoisotopicMass | 317.129489 |
| CLogP | 2.7523 |
| CLogS | -3.695 |
| H Acceptors | 4 |
| H Donors | 1 |
| TotalSurfaceArea | 245.45 |
| Relative PSA | 0.16431 |
| PolarSurfaceArea | 50.85 |
| Druglikeness | -0.064953 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.54545 |
| Fragments | 1 |
| Non HAtoms | 22 |
| NonCHAtoms | 5 |
| Electronegative Atoms | 5 |
| Rotatable Bond | 3 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 1 |
| Aromatic Atoms | 6 |
| Sp3Atoms | 8 |
| Symmetricatoms | 4 |
| StereoCon |
Click to Load Molecule:
1 - (Z)-[(3Z)-3-[(4-chlorophenyl)methylidene]-2-morpholin-4-ylcyclopenten-1-yl]methylidenehydrazine | 2 - (Z)-[(3Z)-3-[(4-chlorophenyl)methylidene]-2-morpholin-4-ylcyclopenten-1-yl]methylidenehydrazine