| MolName | N-[2-[(2Z)-2-[[5-chloro-2-[(4-cyanophenyl)methoxy]phenyl]methylidene]hydrazinyl]-2-oxoethyl]-1,3-benzodioxole-5-carboxamide |
| MolecularFormula | C25H19N4O5Cl |
| Smiles | N#Cc1ccc(COc(cc2)c(/C=N\NC(CNC(c(cc3)cc4c3OCO4)=O)=O)cc2Cl)cc1 |
| InChI | InChI=1S/C25H19ClN4O5/c26-20-6-8-21(33-14-17-3-1-16(11-27)2-4-17)19(9-20)12-29-30-24(31)13-28-25(32)18-5-7-22-23(10-18)35-15-34-22/h1-10,12H,13-15H2,(H,28,32)(H,30,31) |
| InChIK | HLYHSLJVUKQFCL-UHFFFAOYSA-N |
| TotalMolweight | 490.902 |
| Molweight | 490.902 |
| MonoisotopicMass | 490.104398 |
| CLogP | 4.1864 |
| CLogS | -7.049 |
| H Acceptors | 9 |
| H Donors | 2 |
| TotalSurfaceArea | 370.87 |
| Relative PSA | 0.28061 |
| PolarSurfaceArea | 122.04 |
| Druglikeness | 0.74667 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.62857 |
| Fragments | 1 |
| Non HAtoms | 35 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 8 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 6 |
| Symmetricatoms | 2 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[2-[(2Z)-2-[[5-chloro-2-[(4-cyanophenyl)methoxy]phenyl]methylidene]hydrazinyl]-2-oxoethyl]-1,3-benzodioxole-5-carboxamide | 2 - N-[2-[(2Z)-2-[[5-chloro-2-[(4-cyanophenyl)methoxy]phenyl]methylidene]hydrazinyl]-2-oxoethyl]-1,3-benzodioxole-5-carboxamide