| MolName | (Z)-3-[(Z)-1,3-benzodioxol-5-ylmethylideneamino]-4-(1-benzofuran-2-yl)-N-(2,4-difluorophenyl)-1,3-thiazol-2-imine |
| MolecularFormula | C25H15N3O3F2S |
| Smiles | Fc(cc1)cc(F)c1/N=C1\SC=C(c2cc(cccc3)c3o2)N1/N=C\c(cc1)cc2c1OCO2 |
| InChI | InChI=1S/C25H15F2N3O3S/c26-17-6-7-19(18(27)11-17)29-25-30(28-12-15-5-8-22-24(9-15)32-14-31-22)20(13-34-25)23-10-16-3-1-2-4-21(16)33-23/h1-13H,14H2 |
| InChIK | HMBCAHPASAOPGP-UHFFFAOYSA-N |
| TotalMolweight | 475.474 |
| Molweight | 475.474 |
| MonoisotopicMass | 475.080218 |
| CLogP | 6.1827 |
| CLogS | -8.156 |
| H Acceptors | 6 |
| TotalSurfaceArea | 336.76 |
| Relative PSA | 0.23212 |
| PolarSurfaceArea | 84.86 |
| Druglikeness | 2.47 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.44118 |
| Fragments | 1 |
| Non HAtoms | 34 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 4 |
| Rings Closures | 6 |
| Small Rings | 6 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 21 |
| Sp3Atoms | 4 |
| StereoCon |
Click to Load Molecule:
1 - (Z)-3-[(Z)-1,3-benzodioxol-5-ylmethylideneamino]-4-(1-benzofuran-2-yl)-N-(2,4-difluorophenyl)-1,3-thiazol-2-imine | 2 - (Z)-3-[(Z)-1,3-benzodioxol-5-ylmethylideneamino]-4-(1-benzofuran-2-yl)-N-(2,4-difluorophenyl)-1,3-thiazol-2-imine