| MolName | N-[(Z)-(6-bromo-1,3-benzodioxol-5-yl)methylideneamino]-5-fluoro-4-morpholin-4-ylpyrimidin-2-amine |
| MolecularFormula | C16H15N5O3BrF |
| Smiles | Fc1c(N2CCOCC2)nc(N/N=C\c(cc2OCOc2c2)c2Br)nc1 |
| InChI | InChI=1S/C16H15BrFN5O3/c17-11-6-14-13(25-9-26-14)5-10(11)7-20-22-16-19-8-12(18)15(21-16)23-1-3-24-4-2-23/h5-8H,1-4,9H2,(H,19,21,22) |
| InChIK | HMMGKNIBUFHGJP-UHFFFAOYSA-N |
| TotalMolweight | 424.229 |
| Molweight | 424.229 |
| MonoisotopicMass | 423.034229 |
| CLogP | 4.605 |
| CLogS | -4.903 |
| H Acceptors | 8 |
| H Donors | 1 |
| TotalSurfaceArea | 273.84 |
| Relative PSA | 0.28652 |
| PolarSurfaceArea | 81.1 |
| Druglikeness | 0.088057 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.57692 |
| Fragments | 1 |
| Non HAtoms | 26 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 4 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 9 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 2 |
| BasicNitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(6-bromo-1,3-benzodioxol-5-yl)methylideneamino]-5-fluoro-4-morpholin-4-ylpyrimidin-2-amine | 2 - N-[(Z)-(6-bromo-1,3-benzodioxol-5-yl)methylideneamino]-5-fluoro-4-morpholin-4-ylpyrimidin-2-amine