| MolName | N-[(Z)-(2,4-dichlorophenyl)methylideneamino]-N'-phenylpyridine-2-carboximidamide |
| MolecularFormula | C19H14N4Cl2 |
| Smiles | Clc1cc(Cl)c(/C=N\N/C(/c2ncccc2)=N/c2ccccc2)cc1 |
| InChI | InChI=1S/C19H14Cl2N4/c20-15-10-9-14(17(21)12-15)13-23-25-19(18-8-4-5-11-22-18)24-16-6-2-1-3-7-16/h1-13H,(H,24,25) |
| InChIK | HMNFZOLNAVJCNT-UHFFFAOYSA-N |
| TotalMolweight | 369.254 |
| Molweight | 369.254 |
| MonoisotopicMass | 368.05955 |
| CLogP | 4.9072 |
| CLogS | -5.64 |
| H Acceptors | 4 |
| H Donors | 1 |
| TotalSurfaceArea | 281.57 |
| Relative PSA | 0.16142 |
| PolarSurfaceArea | 49.64 |
| Druglikeness | 2.6191 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.56 |
| Fragments | 1 |
| Non HAtoms | 25 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 4 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(2,4-dichlorophenyl)methylideneamino]-N'-phenylpyridine-2-carboximidamide | 2 - N-[(Z)-(2,4-dichlorophenyl)methylideneamino]-N'-phenylpyridine-2-carboximidamide