| MolName | 5-bromo-N-[(Z)-[3-bromo-4-(naphthalen-2-ylmethoxy)phenyl]methylideneamino]-1-benzofuran-2-carboxamide |
| MolecularFormula | C27H18N2O3Br2 |
| Smiles | O=C(c1cc(cc(cc2)Br)c2o1)N/N=C\c(cc1)cc(Br)c1OCc1cc2ccccc2cc1 |
| InChI | InChI=1S/C27H18Br2N2O3/c28-22-8-10-24-21(13-22)14-26(34-24)27(32)31-30-15-17-6-9-25(23(29)12-17)33-16-18-5-7-19-3-1-2-4-20(19)11-18/h1-15H,16H2,(H,31,32) |
| InChIK | HMTWKDWDSQBHTN-UHFFFAOYSA-N |
| TotalMolweight | 578.259 |
| Molweight | 578.259 |
| MonoisotopicMass | 575.968415 |
| CLogP | 7.7001 |
| CLogS | -9.519 |
| H Acceptors | 5 |
| H Donors | 1 |
| TotalSurfaceArea | 366.66 |
| Relative PSA | 0.16397 |
| PolarSurfaceArea | 63.83 |
| Druglikeness | 2.6867 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.64706 |
| Fragments | 1 |
| Non HAtoms | 34 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 6 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 5 |
| Aromatic Atoms | 25 |
| Sp3Atoms | 2 |
| StereoCon |
Click to Load Molecule:
1 - 5-bromo-N-[(Z)-[3-bromo-4-(naphthalen-2-ylmethoxy)phenyl]methylideneamino]-1-benzofuran-2-carboxamide | 2 - 5-bromo-N-[(Z)-[3-bromo-4-(naphthalen-2-ylmethoxy)phenyl]methylideneamino]-1-benzofuran-2-carboxamide