| MolName | 2-[(Z)-(2-phenylmethoxyphenyl)methylideneamino]guanidine |
| MolecularFormula | C15H16N4O |
| Smiles | NC(N)=N/N=C\c(cccc1)c1OCc1ccccc1 |
| InChI | InChI=1S/C15H16N4O/c16-15(17)19-18-10-13-8-4-5-9-14(13)20-11-12-6-2-1-3-7-12/h1-10H,11H2,(H4,16,17,19) |
| InChIK | HNCAEHFZFMLIPM-UHFFFAOYSA-N |
| TotalMolweight | 268.319 |
| Molweight | 268.319 |
| MonoisotopicMass | 268.132411 |
| CLogP | 3.2214 |
| CLogS | -4.331 |
| H Acceptors | 5 |
| H Donors | 2 |
| TotalSurfaceArea | 221.55 |
| Relative PSA | 0.28689 |
| PolarSurfaceArea | 85.99 |
| Druglikeness | 0.94978 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | dimethylene-hydrazine; imine/hydrazone of aldehyde |
| Shape Index | 0.65 |
| Fragments | 1 |
| Non HAtoms | 20 |
| NonCHAtoms | 5 |
| Electronegative Atoms | 5 |
| Rotatable Bond | 5 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 2 |
| Symmetricatoms | 3 |
| BasicNitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-[(Z)-(2-phenylmethoxyphenyl)methylideneamino]guanidine | 2 - 2-[(Z)-(2-phenylmethoxyphenyl)methylideneamino]guanidine