| MolName | 3-[[2-[(2Z)-2-[(Z)-2-chloro-3-(4-nitrophenyl)prop-2-enylidene]hydrazinyl]-2-oxoacetyl]amino]benzoate |
| MolecularFormula | C18H12N4O6Cl |
| Smiles | [O-]C(c1cccc(NC(C(N/N=C\C(\Cl)=C\c(cc2)ccc2[N+]([O-])=O)=O)=O)c1)=O |
| InChI | InChI=1S/C18H13ClN4O6/c19-13(8-11-4-6-15(7-5-11)23(28)29)10-20-22-17(25)16(24)21-14-3-1-2-12(9-14)18(26)27/h1-10H,(H,21,24)(H,22,25)(H,26,27)/p-1 |
| InChIK | HNDQQBITMJFFPU-UHFFFAOYSA-M |
| TotalMolweight | 415.768 |
| Molweight | 415.768 |
| MonoisotopicMass | 415.044538 |
| CLogP | -0.8887 |
| CLogS | -4.981 |
| H Acceptors | 10 |
| H Donors | 2 |
| TotalSurfaceArea | 305.28 |
| Relative PSA | 0.38735 |
| PolarSurfaceArea | 156.51 |
| Druglikeness | -1.0447 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde; limit! oxal-diamide |
| Shape Index | 0.65517 |
| Fragments | 1 |
| Non HAtoms | 29 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 7 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 2 |
| Symmetricatoms | 2 |
| Amides | 1 |
| AcidicOxygens | 2 |
| StereoCon |
Click to Load Molecule:
1 - 3-[[2-[(2Z)-2-[(Z)-2-chloro-3-(4-nitrophenyl)prop-2-enylidene]hydrazinyl]-2-oxoacetyl]amino]benzoate | 2 - 3-[[2-[(2Z)-2-[(Z)-2-chloro-3-(4-nitrophenyl)prop-2-enylidene]hydrazinyl]-2-oxoacetyl]amino]benzoate