| MolName | 4-chloro-N-[2-oxo-2-[(2Z)-2-[(2,4,6-tribromo-3-hydroxyphenyl)methylidene]hydrazinyl]ethyl]benzamide |
| MolecularFormula | C16H11N3O3Br3Cl |
| Smiles | Oc(c(Br)cc(Br)c1/C=N\NC(CNC(c(cc2)ccc2Cl)=O)=O)c1Br |
| InChI | InChI=1S/C16H11Br3ClN3O3/c17-11-5-12(18)15(25)14(19)10(11)6-22-23-13(24)7-21-16(26)8-1-3-9(20)4-2-8/h1-6,25H,7H2,(H,21,26)(H,23,24) |
| InChIK | HNFMSUVOHMLXES-UHFFFAOYSA-N |
| TotalMolweight | 568.446 |
| Molweight | 568.446 |
| MonoisotopicMass | 564.803902 |
| CLogP | 4.7212 |
| CLogS | -6.43 |
| H Acceptors | 6 |
| H Donors | 3 |
| TotalSurfaceArea | 307.62 |
| Relative PSA | 0.23929 |
| PolarSurfaceArea | 90.79 |
| Druglikeness | 3.5489 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde; polyhalo aromatic ring |
| Shape Index | 0.65385 |
| Fragments | 1 |
| Non HAtoms | 26 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 5 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 2 |
| Symmetricatoms | 2 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - 4-chloro-N-[2-oxo-2-[(2Z)-2-[(2,4,6-tribromo-3-hydroxyphenyl)methylidene]hydrazinyl]ethyl]benzamide | 2 - 4-chloro-N-[2-oxo-2-[(2Z)-2-[(2,4,6-tribromo-3-hydroxyphenyl)methylidene]hydrazinyl]ethyl]benzamide