| MolName | N-[(Z)-(4-nitrophenyl)methylideneamino]-2-[5-(phenylcarbamoylamino)-1,3,4-thiadiazol-2-yl]acetamide |
| MolecularFormula | C18H15N7O4S |
| Smiles | [O-][N+](c1ccc(/C=N\NC(Cc2nnc(NC(Nc3ccccc3)=O)s2)=O)cc1)=O |
| InChI | InChI=1S/C18H15N7O4S/c26-15(22-19-11-12-6-8-14(9-7-12)25(28)29)10-16-23-24-18(30-16)21-17(27)20-13-4-2-1-3-5-13/h1-9,11H,10H2,(H,22,26)(H2,20,21,24,27) |
| InChIK | HNGCCWBVRCHUEB-UHFFFAOYSA-N |
| TotalMolweight | 425.428 |
| Molweight | 425.428 |
| MonoisotopicMass | 425.090623 |
| CLogP | 2.2625 |
| CLogS | -5.381 |
| H Acceptors | 11 |
| H Donors | 3 |
| TotalSurfaceArea | 318.31 |
| Relative PSA | 0.45456 |
| PolarSurfaceArea | 182.43 |
| Druglikeness | 1.4 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.7 |
| Fragments | 1 |
| Non HAtoms | 30 |
| NonCHAtoms | 12 |
| Electronegative Atoms | 12 |
| Rotatable Bond | 7 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 2 |
| Symmetricatoms | 4 |
| Amides | 2 |
| Aromatic Nitrogens | 2 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(4-nitrophenyl)methylideneamino]-2-[5-(phenylcarbamoylamino)-1,3,4-thiadiazol-2-yl]acetamide | 2 - N-[(Z)-(4-nitrophenyl)methylideneamino]-2-[5-(phenylcarbamoylamino)-1,3,4-thiadiazol-2-yl]acetamide