| MolName | 3-N-[(Z)-(3-iodophenyl)methylideneamino]-1,2,4-triazole-3,4-diamine |
| MolecularFormula | C9H9N6I |
| Smiles | Nn1c(N/N=C\c2cccc(I)c2)nnc1 |
| InChI | InChI=1S/C9H9IN6/c10-8-3-1-2-7(4-8)5-12-14-9-15-13-6-16(9)11/h1-6H,11H2,(H,14,15) |
| InChIK | HNOYYOOLZZTGEV-UHFFFAOYSA-N |
| TotalMolweight | 328.112 |
| Molweight | 328.112 |
| MonoisotopicMass | 327.993342 |
| CLogP | 3.4399 |
| CLogS | -5.77 |
| H Acceptors | 6 |
| H Donors | 2 |
| TotalSurfaceArea | 190.76 |
| Relative PSA | 0.35149 |
| PolarSurfaceArea | 81.12 |
| Druglikeness | 2.6909 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | low |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.625 |
| Fragments | 1 |
| Non HAtoms | 16 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 3 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Sp3Atoms | 1 |
| Aromatic Nitrogens | 3 |
| BasicNitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 3-N-[(Z)-(3-iodophenyl)methylideneamino]-1,2,4-triazole-3,4-diamine | 2 - 3-N-[(Z)-(3-iodophenyl)methylideneamino]-1,2,4-triazole-3,4-diamine