| MolName | N-[(Z)-[1-(4-fluorophenyl)pyrrol-2-yl]methylideneamino]-2-hydroxy-2,2-diphenylacetamide |
| MolecularFormula | C25H20N3O2F |
| Smiles | OC(C(N/N=C\c1cccn1-c(cc1)ccc1F)=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H20FN3O2/c26-21-13-15-22(16-14-21)29-17-7-12-23(29)18-27-28-24(30)25(31,19-8-3-1-4-9-19)20-10-5-2-6-11-20/h1-18,31H,(H,28,30) |
| InChIK | HNUHEMCIHGCTHT-UHFFFAOYSA-N |
| TotalMolweight | 413.451 |
| Molweight | 413.451 |
| MonoisotopicMass | 413.153955 |
| CLogP | 3.8216 |
| CLogS | -7.078 |
| H Acceptors | 5 |
| H Donors | 2 |
| TotalSurfaceArea | 318.82 |
| Relative PSA | 0.17558 |
| PolarSurfaceArea | 66.62 |
| Druglikeness | 5.0936 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.51613 |
| Fragments | 1 |
| Non HAtoms | 31 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 6 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 23 |
| Sp3Atoms | 2 |
| Symmetricatoms | 10 |
| Aromatic Nitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-[1-(4-fluorophenyl)pyrrol-2-yl]methylideneamino]-2-hydroxy-2,2-diphenylacetamide | 2 - N-[(Z)-[1-(4-fluorophenyl)pyrrol-2-yl]methylideneamino]-2-hydroxy-2,2-diphenylacetamide