| MolName | (Z)-1-[1-[(2-fluorophenyl)methyl]indol-3-yl]-N-(1,2,4-triazol-4-yl)methanimine |
| MolecularFormula | C18H14N5F |
| Smiles | Fc1c(Cn2c(cccc3)c3c(/C=N\n3cnnc3)c2)cccc1 |
| InChI | InChI=1S/C18H14FN5/c19-17-7-3-1-5-14(17)10-23-11-15(9-22-24-12-20-21-13-24)16-6-2-4-8-18(16)23/h1-9,11-13H,10H2 |
| InChIK | HNWXMZFLAOSDSE-UHFFFAOYSA-N |
| TotalMolweight | 319.342 |
| Molweight | 319.342 |
| MonoisotopicMass | 319.123323 |
| CLogP | 2.8588 |
| CLogS | -5.602 |
| H Acceptors | 5 |
| TotalSurfaceArea | 248.17 |
| Relative PSA | 0.19015 |
| PolarSurfaceArea | 48 |
| Druglikeness | 3.946 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.54167 |
| Fragments | 1 |
| Non HAtoms | 24 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 4 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 20 |
| Sp3Atoms | 1 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 4 |
| StereoCon |
Click to Load Molecule:
1 - (Z)-1-[1-[(2-fluorophenyl)methyl]indol-3-yl]-N-(1,2,4-triazol-4-yl)methanimine | 2 - (Z)-1-[1-[(2-fluorophenyl)methyl]indol-3-yl]-N-(1,2,4-triazol-4-yl)methanimine