| MolName | 2-(4-chlorophenoxy)-N-[(Z)-[5-(2,4-dichlorophenyl)furan-2-yl]methylideneamino]acetamide |
| MolecularFormula | C19H13N2O3Cl3 |
| Smiles | O=C(COc(cc1)ccc1Cl)N/N=C\c1ccc(-c(ccc(Cl)c2)c2Cl)o1 |
| InChI | InChI=1S/C19H13Cl3N2O3/c20-12-1-4-14(5-2-12)26-11-19(25)24-23-10-15-6-8-18(27-15)16-7-3-13(21)9-17(16)22/h1-10H,11H2,(H,24,25) |
| InChIK | HOLOKKGFPPHNHN-UHFFFAOYSA-N |
| TotalMolweight | 423.682 |
| Molweight | 423.682 |
| MonoisotopicMass | 421.999174 |
| CLogP | 5.5334 |
| CLogS | -7.169 |
| H Acceptors | 5 |
| H Donors | 1 |
| TotalSurfaceArea | 306.46 |
| Relative PSA | 0.19618 |
| PolarSurfaceArea | 63.83 |
| Druglikeness | 6.4337 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.7037 |
| Fragments | 1 |
| Non HAtoms | 27 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 6 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 2 |
| Symmetricatoms | 2 |
| StereoCon |
Click to Load Molecule:
1 - 2-(4-chlorophenoxy)-N-[(Z)-[5-(2,4-dichlorophenyl)furan-2-yl]methylideneamino]acetamide | 2 - 2-(4-chlorophenoxy)-N-[(Z)-[5-(2,4-dichlorophenyl)furan-2-yl]methylideneamino]acetamide